C17H18N3O4P — CID 154672976
[4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]phosphonous acid (PubChem CID 154672976) has the molecular formula C17H18N3O4P and a molecular weight of 359.32 g/mol. Its IUPAC name is [4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]phosphonous acid.
| Compound Name | [4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]phosphonous acid |
|---|---|
| PubChem CID | 154672976 |
| Molecular Formula | C17H18N3O4P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenyl]phosphonous acid |
| SMILES | COc1cc2ncnc(NCc3ccc(P(O)O)cc3)c2cc1OC |
| InChI | InChI=1S/C17H18N3O4P/c1-23-15-7-13-14(8-16(15)24-2)19-10-20-17(13)18-9-11-3-5-12(6-4-11)25(21)22/h3-8,10,21-22H,9H2,1-2H3,(H,18,19,20) |
| InChIKey | MBKNRVJRPMSKNG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|