C17H16FN5O2 — CID 22921739
7-N-ethyl-4-N-[(4-fluorophenyl)methyl]-6-nitroquinazoline-4,7-diamine (PubChem CID 22921739) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is 7-N-ethyl-4-N-[(4-fluorophenyl)methyl]-6-nitroquinazoline-4,7-diamine.
| Compound Name | 7-N-ethyl-4-N-[(4-fluorophenyl)methyl]-6-nitroquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 22921739 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 7-N-ethyl-4-N-[(4-fluorophenyl)methyl]-6-nitroquinazoline-4,7-diamine |
| SMILES | CCNc1cc2ncnc(NCc3ccc(F)cc3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16FN5O2/c1-2-19-15-8-14-13(7-16(15)23(24)25)17(22-10-21-14)20-9-11-3-5-12(18)6-4-11/h3-8,10,19H,2,9H2,1H3,(H,20,21,22) |
| InChIKey | LNXIUAOGCOQVPH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|