C25H33N7O4 — CID 67704111
1-[4-[2-[4-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenoxy]ethyl]piperazin-1-yl]ethanol (PubChem CID 67704111) has the molecular formula C25H33N7O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is 1-[4-[2-[4-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenoxy]ethyl]piperazin-1-yl]ethanol.
| Compound Name | 1-[4-[2-[4-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenoxy]ethyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 67704111 |
| Molecular Formula | C25H33N7O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 1-[4-[2-[4-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenoxy]ethyl]piperazin-1-yl]ethanol |
| SMILES | CCNc1cc2ncnc(NCc3ccc(OCCN4CCN(C(C)O)CC4)cc3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H33N7O4/c1-3-26-23-15-22-21(14-24(23)32(34)35)25(29-17-28-22)27-16-19-4-6-20(7-5-19)36-13-12-30-8-10-31(11-9-30)18(2)33/h4-7,14-15,17-18,26,33H,3,8-13,16H2,1-2H3,(H,27,28,29) |
| InChIKey | JHVWGNIVWJHQHV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|