C27H36N8O3 — CID 21465385
2-[4-[[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 21465385) has the molecular formula C27H36N8O3 and a molecular weight of 520.64 g/mol. Its IUPAC name is 2-[4-[[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 21465385 |
| Molecular Formula | C27H36N8O3 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2-[4-[[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]phenyl]methyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CCNc1cc2ncnc(NCc3ccccc3CN3CCN(CC(=O)NC(C)C)CC3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H36N8O3/c1-4-28-24-14-23-22(13-25(24)35(37)38)27(31-18-30-23)29-15-20-7-5-6-8-21(20)16-33-9-11-34(12-10-33)17-26(36)32-19(2)3/h5-8,13-14,18-19,28H,4,9-12,15-17H2,1-3H3,(H,32,36)(H,29,30,31) |
| InChIKey | VDPMHGSERNNXMU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|