C27H32N6O2 — CID 54491828
4-N-[[2-(1-adamantylamino)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine (PubChem CID 54491828) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 4-N-[[2-(1-adamantylamino)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine.
| Compound Name | 4-N-[[2-(1-adamantylamino)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 54491828 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 4-N-[[2-(1-adamantylamino)phenyl]methyl]-7-N-ethyl-6-nitroquinazoline-4,7-diamine |
| SMILES | CCNc1cc2ncnc(NCc3ccccc3NC34CC5CC(CC(C5)C3)C4)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H32N6O2/c1-2-28-24-11-23-21(10-25(24)33(34)35)26(31-16-30-23)29-15-20-5-3-4-6-22(20)32-27-12-17-7-18(13-27)9-19(8-17)14-27/h3-6,10-11,16-19,28,32H,2,7-9,12-15H2,1H3,(H,29,30,31) |
| InChIKey | XWGULOLGWHIFBL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|