C24H30N6O4 — CID 21465428
7-N-ethyl-4-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methyl]-6-nitroquinazoline-4,7-diamine (PubChem CID 21465428) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 7-N-ethyl-4-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methyl]-6-nitroquinazoline-4,7-diamine.
| Compound Name | 7-N-ethyl-4-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methyl]-6-nitroquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 21465428 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 7-N-ethyl-4-N-[[3-(3-morpholin-4-ylpropoxy)phenyl]methyl]-6-nitroquinazoline-4,7-diamine |
| SMILES | CCNc1cc2ncnc(NCc3cccc(OCCCN4CCOCC4)c3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H30N6O4/c1-2-25-22-15-21-20(14-23(22)30(31)32)24(28-17-27-21)26-16-18-5-3-6-19(13-18)34-10-4-7-29-8-11-33-12-9-29/h3,5-6,13-15,17,25H,2,4,7-12,16H2,1H3,(H,26,27,28) |
| InChIKey | RJEUZLWSZWMZGG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|