C15H15N5O2S — CID 22921847
7-N-ethyl-6-nitro-4-N-(thiophen-2-ylmethyl)quinazoline-4,7-diamine (PubChem CID 22921847) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 7-N-ethyl-6-nitro-4-N-(thiophen-2-ylmethyl)quinazoline-4,7-diamine.
| Compound Name | 7-N-ethyl-6-nitro-4-N-(thiophen-2-ylmethyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 22921847 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 7-N-ethyl-6-nitro-4-N-(thiophen-2-ylmethyl)quinazoline-4,7-diamine |
| SMILES | CCNc1cc2ncnc(NCc3cccs3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N5O2S/c1-2-16-13-7-12-11(6-14(13)20(21)22)15(19-9-18-12)17-8-10-4-3-5-23-10/h3-7,9,16H,2,8H2,1H3,(H,17,18,19) |
| InChIKey | RVKXKVSYBTWKCY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|