C21H26N6O3 — CID 23293052
4-[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]anilino]butan-1-ol (PubChem CID 23293052) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 4-[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]anilino]butan-1-ol.
| Compound Name | 4-[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]anilino]butan-1-ol |
|---|---|
| PubChem CID | 23293052 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 4-[2-[[[7-(ethylamino)-6-nitroquinazolin-4-yl]amino]methyl]anilino]butan-1-ol |
| SMILES | CCNc1cc2ncnc(NCc3ccccc3NCCCCO)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N6O3/c1-2-22-19-12-18-16(11-20(19)27(29)30)21(26-14-25-18)24-13-15-7-3-4-8-17(15)23-9-5-6-10-28/h3-4,7-8,11-12,14,22-23,28H,2,5-6,9-10,13H2,1H3,(H,24,25,26) |
| InChIKey | WEYYLESHXYTTFE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|