C22H26N6O2 — CID 23293097
7-N-ethyl-6-nitro-4-N-[(2-piperidin-1-ylphenyl)methyl]quinazoline-4,7-diamine (PubChem CID 23293097) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 7-N-ethyl-6-nitro-4-N-[(2-piperidin-1-ylphenyl)methyl]quinazoline-4,7-diamine.
| Compound Name | 7-N-ethyl-6-nitro-4-N-[(2-piperidin-1-ylphenyl)methyl]quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 23293097 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 7-N-ethyl-6-nitro-4-N-[(2-piperidin-1-ylphenyl)methyl]quinazoline-4,7-diamine |
| SMILES | CCNc1cc2ncnc(NCc3ccccc3N3CCCCC3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N6O2/c1-2-23-19-13-18-17(12-21(19)28(29)30)22(26-15-25-18)24-14-16-8-4-5-9-20(16)27-10-6-3-7-11-27/h4-5,8-9,12-13,15,23H,2-3,6-7,10-11,14H2,1H3,(H,24,25,26) |
| InChIKey | LKGLZIJIHQFWPJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|