C25H32N6O3S — CID 139838757
[1-[2-[[[7-(ethylamino)-2-ethylsulfanyl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol (PubChem CID 139838757) has the molecular formula C25H32N6O3S and a molecular weight of 496.64 g/mol. Its IUPAC name is [1-[2-[[[7-(ethylamino)-2-ethylsulfanyl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[2-[[[7-(ethylamino)-2-ethylsulfanyl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 139838757 |
| Molecular Formula | C25H32N6O3S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | [1-[2-[[[7-(ethylamino)-2-ethylsulfanyl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol |
| SMILES | CCNc1cc2nc(SCC)nc(NCc3ccccc3N3CCC(CO)CC3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H32N6O3S/c1-3-26-21-14-20-19(13-23(21)31(33)34)24(29-25(28-20)35-4-2)27-15-18-7-5-6-8-22(18)30-11-9-17(16-32)10-12-30/h5-8,13-14,17,26,32H,3-4,9-12,15-16H2,1-2H3,(H,27,28,29) |
| InChIKey | ZPOXRTQUAMJUIF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|