C26H30N8O3 — CID 139838763
[1-[2-[[[7-(ethylamino)-2-imidazol-1-yl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol (PubChem CID 139838763) has the molecular formula C26H30N8O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is [1-[2-[[[7-(ethylamino)-2-imidazol-1-yl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[2-[[[7-(ethylamino)-2-imidazol-1-yl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 139838763 |
| Molecular Formula | C26H30N8O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | [1-[2-[[[7-(ethylamino)-2-imidazol-1-yl-6-nitroquinazolin-4-yl]amino]methyl]phenyl]piperidin-4-yl]methanol |
| SMILES | CCNc1cc2nc(-n3ccnc3)nc(NCc3ccccc3N3CCC(CO)CC3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H30N8O3/c1-2-28-22-14-21-20(13-24(22)34(36)37)25(31-26(30-21)33-12-9-27-17-33)29-15-19-5-3-4-6-23(19)32-10-7-18(16-35)8-11-32/h3-6,9,12-14,17-18,28,35H,2,7-8,10-11,15-16H2,1H3,(H,29,30,31) |
| InChIKey | BCWOZFAYJYFBOT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|