C18H15ClN6O2 — CID 19392308
N-benzyl-2-imidazol-1-yl-6-nitroquinazolin-4-amine;hydrochloride (PubChem CID 19392308) has the molecular formula C18H15ClN6O2 and a molecular weight of 382.81 g/mol. Its IUPAC name is N-benzyl-2-imidazol-1-yl-6-nitroquinazolin-4-amine;hydrochloride.
| Compound Name | N-benzyl-2-imidazol-1-yl-6-nitroquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 19392308 |
| Molecular Formula | C18H15ClN6O2 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-benzyl-2-imidazol-1-yl-6-nitroquinazolin-4-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2nc(-n3ccnc3)nc(NCc3ccccc3)c2c1 |
| InChI | InChI=1S/C18H14N6O2.ClH/c25-24(26)14-6-7-16-15(10-14)17(20-11-13-4-2-1-3-5-13)22-18(21-16)23-9-8-19-12-23;/h1-10,12H,11H2,(H,20,21,22);1H |
| InChIKey | JCTQDEWSVHCJNZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|