C26H22N6O — CID 19392238
N-benzyl-4-(benzylamino)-2-imidazol-1-ylquinazoline-6-carboxamide (PubChem CID 19392238) has the molecular formula C26H22N6O and a molecular weight of 434.50 g/mol. Its IUPAC name is N-benzyl-4-(benzylamino)-2-imidazol-1-ylquinazoline-6-carboxamide.
| Compound Name | N-benzyl-4-(benzylamino)-2-imidazol-1-ylquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 19392238 |
| Molecular Formula | C26H22N6O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N-benzyl-4-(benzylamino)-2-imidazol-1-ylquinazoline-6-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2nc(-n3ccnc3)nc(NCc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H22N6O/c33-25(29-17-20-9-5-2-6-10-20)21-11-12-23-22(15-21)24(28-16-19-7-3-1-4-8-19)31-26(30-23)32-14-13-27-18-32/h1-15,18H,16-17H2,(H,29,33)(H,28,30,31) |
| InChIKey | WOZPHIILGCSZRL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |