C15H17N5O3S — CID 19392342
2-imidazol-1-yl-N-(2-methoxyethyl)-6-methylsulfonylquinazolin-4-amine (PubChem CID 19392342) has the molecular formula C15H17N5O3S and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-(2-methoxyethyl)-6-methylsulfonylquinazolin-4-amine.
| Compound Name | 2-imidazol-1-yl-N-(2-methoxyethyl)-6-methylsulfonylquinazolin-4-amine |
|---|---|
| PubChem CID | 19392342 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-imidazol-1-yl-N-(2-methoxyethyl)-6-methylsulfonylquinazolin-4-amine |
| SMILES | COCCNc1nc(-n2ccnc2)nc2ccc(S(C)(=O)=O)cc12 |
| InChI | InChI=1S/C15H17N5O3S/c1-23-8-6-17-14-12-9-11(24(2,21)22)3-4-13(12)18-15(19-14)20-7-5-16-10-20/h3-5,7,9-10H,6,8H2,1-2H3,(H,17,18,19) |
| InChIKey | NNMZTEVBRWBTGN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|