C10H12N6O3 — CID 22534884
6-imidazol-1-yl-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine (PubChem CID 22534884) has the molecular formula C10H12N6O3 and a molecular weight of 264.25 g/mol. Its IUPAC name is 6-imidazol-1-yl-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-imidazol-1-yl-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22534884 |
| Molecular Formula | C10H12N6O3 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 6-imidazol-1-yl-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine |
| SMILES | COCCNc1ncnc(-n2ccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N6O3/c1-19-5-3-12-9-8(16(17)18)10(14-6-13-9)15-4-2-11-7-15/h2,4,6-7H,3,5H2,1H3,(H,12,13,14) |
| InChIKey | IYXQWBQSRCNZQE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|