C9H16N6O3 — CID 22528115
6-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine (PubChem CID 22528115) has the molecular formula C9H16N6O3 and a molecular weight of 256.27 g/mol. Its IUPAC name is 6-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22528115 |
| Molecular Formula | C9H16N6O3 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 6-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)-5-nitropyrimidin-4-amine |
| SMILES | COCCNc1ncnc(NN(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N6O3/c1-14(2)13-9-7(15(16)17)8(11-6-12-9)10-4-5-18-3/h6H,4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | IILDICJQKGMOEU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|