C11H20N6O2 — CID 22528158
6-(2,2-dimethylhydrazinyl)-N-(3-methylbutyl)-5-nitropyrimidin-4-amine (PubChem CID 22528158) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-(2,2-dimethylhydrazinyl)-N-(3-methylbutyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2,2-dimethylhydrazinyl)-N-(3-methylbutyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22528158 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 6-(2,2-dimethylhydrazinyl)-N-(3-methylbutyl)-5-nitropyrimidin-4-amine |
| SMILES | CC(C)CCNc1ncnc(NN(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H20N6O2/c1-8(2)5-6-12-10-9(17(18)19)11(14-7-13-10)15-16(3)4/h7-8H,5-6H2,1-4H3,(H2,12,13,14,15) |
| InChIKey | HMJMSSIQXZULLZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|