C26H30N6O6 — CID 139838762
ethyl 1-[4-(1,3-benzodioxol-5-ylmethylamino)-7-(ethylamino)-6-nitroquinazolin-2-yl]piperidine-4-carboxylate (PubChem CID 139838762) has the molecular formula C26H30N6O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is ethyl 1-[4-(1,3-benzodioxol-5-ylmethylamino)-7-(ethylamino)-6-nitroquinazolin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(1,3-benzodioxol-5-ylmethylamino)-7-(ethylamino)-6-nitroquinazolin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 139838762 |
| Molecular Formula | C26H30N6O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | ethyl 1-[4-(1,3-benzodioxol-5-ylmethylamino)-7-(ethylamino)-6-nitroquinazolin-2-yl]piperidine-4-carboxylate |
| SMILES | CCNc1cc2nc(N3CCC(C(=O)OCC)CC3)nc(NCc3ccc4c(c3)OCO4)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H30N6O6/c1-3-27-20-13-19-18(12-21(20)32(34)35)24(28-14-16-5-6-22-23(11-16)38-15-37-22)30-26(29-19)31-9-7-17(8-10-31)25(33)36-4-2/h5-6,11-13,17,27H,3-4,7-10,14-15H2,1-2H3,(H,28,29,30) |
| InChIKey | KZRIQEKMIIWAEG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|