C27H32N4O4S — CID 23289817
ethyl 1-[4-[2-(1,3-benzodioxol-5-yl)ethylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate (PubChem CID 23289817) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is ethyl 1-[4-[2-(1,3-benzodioxol-5-yl)ethylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[2-(1,3-benzodioxol-5-yl)ethylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23289817 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | ethyl 1-[4-[2-(1,3-benzodioxol-5-yl)ethylamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc(NCCc3ccc4c(c3)OCO4)c3c4c(sc3n2)CCCC4)CC1 |
| InChI | InChI=1S/C27H32N4O4S/c1-2-33-26(32)18-10-13-31(14-11-18)27-29-24(23-19-5-3-4-6-22(19)36-25(23)30-27)28-12-9-17-7-8-20-21(15-17)35-16-34-20/h7-8,15,18H,2-6,9-14,16H2,1H3,(H,28,29,30) |
| InChIKey | BCHVCCBSEWHKKB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |