C22H23N3O4S — CID 18378934
methyl 3-[4-(1,3-benzodioxol-5-ylmethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanoate (PubChem CID 18378934) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is methyl 3-[4-(1,3-benzodioxol-5-ylmethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanoate.
| Compound Name | methyl 3-[4-(1,3-benzodioxol-5-ylmethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanoate |
|---|---|
| PubChem CID | 18378934 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | methyl 3-[4-(1,3-benzodioxol-5-ylmethylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanoate |
| SMILES | COC(=O)CCc1nc(NCc2ccc3c(c2)OCO3)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C22H23N3O4S/c1-27-19(26)9-8-18-24-21(20-14-4-2-3-5-17(14)30-22(20)25-18)23-11-13-6-7-15-16(10-13)29-12-28-15/h6-7,10H,2-5,8-9,11-12H2,1H3,(H,23,24,25) |
| InChIKey | ABSCSVDLTNLSNA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |