C23H27N3O4S — CID 142662024
methyl 7-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]heptanoate (PubChem CID 142662024) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is methyl 7-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]heptanoate.
| Compound Name | methyl 7-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]heptanoate |
|---|---|
| PubChem CID | 142662024 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | methyl 7-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]heptanoate |
| SMILES | COC(=O)CCCCCCc1nc(NCc2ccc3c(c2)OCO3)c2cc(C)sc2n1 |
| InChI | InChI=1S/C23H27N3O4S/c1-15-11-17-22(24-13-16-9-10-18-19(12-16)30-14-29-18)25-20(26-23(17)31-15)7-5-3-4-6-8-21(27)28-2/h9-12H,3-8,13-14H2,1-2H3,(H,24,25,26) |
| InChIKey | WSNAYZGAHLCDEA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|