C20H21N3O4S — CID 10157760
5-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]pentanoic acid (PubChem CID 10157760) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]pentanoic acid.
| Compound Name | 5-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 10157760 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5-[4-(1,3-benzodioxol-5-ylmethylamino)-6-methylthieno[2,3-d]pyrimidin-2-yl]pentanoic acid |
| SMILES | Cc1cc2c(NCc3ccc4c(c3)OCO4)nc(CCCCC(=O)O)nc2s1 |
| InChI | InChI=1S/C20H21N3O4S/c1-12-8-14-19(21-10-13-6-7-15-16(9-13)27-11-26-15)22-17(23-20(14)28-12)4-2-3-5-18(24)25/h6-9H,2-5,10-11H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | OGJAHBNONYXIQS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|