C22H23ClN4O4 — CID 21183941
6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoic acid (PubChem CID 21183941) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoic acid.
| Compound Name | 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 21183941 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 6-[[4-(1,3-benzodioxol-5-ylmethylamino)-6-chloroquinazolin-2-yl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNc1nc(NCc2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C22H23ClN4O4/c23-15-6-7-17-16(11-15)21(25-12-14-5-8-18-19(10-14)31-13-30-18)27-22(26-17)24-9-3-1-2-4-20(28)29/h5-8,10-11H,1-4,9,12-13H2,(H,28,29)(H2,24,25,26,27) |
| InChIKey | YEWFGVQXTFENNW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|