C29H24ClN3O3 — CID 18847173
N-(1,3-benzodioxol-5-ylmethyl)-4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18847173) has the molecular formula C29H24ClN3O3 and a molecular weight of 497.98 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18847173 |
| Molecular Formula | C29H24ClN3O3 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(Cl)cc12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H24ClN3O3/c30-20-10-12-24-22(15-20)21(29(33-24)25-11-9-19-4-1-2-6-23(19)32-25)5-3-7-28(34)31-16-18-8-13-26-27(14-18)36-17-35-26/h1-2,4,6,8-15,33H,3,5,7,16-17H2,(H,31,34) |
| InChIKey | MBGRXBQKNVGOBV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|