C28H21F4N3O — CID 18847354
4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide (PubChem CID 18847354) has the molecular formula C28H21F4N3O and a molecular weight of 491.49 g/mol. Its IUPAC name is 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 18847354 |
| Molecular Formula | C28H21F4N3O |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(F)cc12)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H21F4N3O/c29-18-13-15-23-20(16-18)19(27(35-23)25-14-12-17-6-1-3-9-22(17)33-25)7-5-11-26(36)34-24-10-4-2-8-21(24)28(30,31)32/h1-4,6,8-10,12-16,35H,5,7,11H2,(H,34,36) |
| InChIKey | CAVHNKGXSGURJO-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|