C27H21ClN4O3 — CID 18847240
4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(2-nitrophenyl)butanamide (PubChem CID 18847240) has the molecular formula C27H21ClN4O3 and a molecular weight of 484.94 g/mol. Its IUPAC name is 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(2-nitrophenyl)butanamide.
| Compound Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(2-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 18847240 |
| Molecular Formula | C27H21ClN4O3 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(2-nitrophenyl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(Cl)cc12)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21ClN4O3/c28-18-13-15-22-20(16-18)19(27(31-22)24-14-12-17-6-1-2-8-21(17)29-24)7-5-11-26(33)30-23-9-3-4-10-25(23)32(34)35/h1-4,6,8-10,12-16,31H,5,7,11H2,(H,30,33) |
| InChIKey | CIXMSGWGSGLQAA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|