C28H24N4O4 — CID 18846915
N-(4-methoxy-2-nitrophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18846915) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18846915 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H24N4O4/c1-36-19-14-16-24(26(17-19)32(34)35)30-27(33)12-6-9-21-20-8-3-5-11-23(20)31-28(21)25-15-13-18-7-2-4-10-22(18)29-25/h2-5,7-8,10-11,13-17,31H,6,9,12H2,1H3,(H,30,33) |
| InChIKey | YJFPNYZUJBOVCU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|