C30H29N3O2 — CID 18847080
N-(4-ethoxyphenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18847080) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(4-ethoxyphenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18847080 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | CCOc1ccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C30H29N3O2/c1-3-35-23-15-13-22(14-16-23)31-29(34)10-6-8-24-25-19-20(2)11-17-27(25)33-30(24)28-18-12-21-7-4-5-9-26(21)32-28/h4-5,7,9,11-19,33H,3,6,8,10H2,1-2H3,(H,31,34) |
| InChIKey | CIMHSONGABQKBP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|