C30H26FN3O3 — CID 18847392
ethyl 4-[4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanoylamino]benzoate (PubChem CID 18847392) has the molecular formula C30H26FN3O3 and a molecular weight of 495.55 g/mol. Its IUPAC name is ethyl 4-[4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanoylamino]benzoate.
| Compound Name | ethyl 4-[4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 18847392 |
| Molecular Formula | C30H26FN3O3 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | ethyl 4-[4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C30H26FN3O3/c1-2-37-30(36)20-10-14-22(15-11-20)32-28(35)9-5-7-23-24-18-21(31)13-17-26(24)34-29(23)27-16-12-19-6-3-4-8-25(19)33-27/h3-4,6,8,10-18,34H,2,5,7,9H2,1H3,(H,32,35) |
| InChIKey | GEUWOAZPWVRLJX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|