C33H28FN3O — CID 18847450
N-ethyl-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-naphthalen-1-ylbutanamide (PubChem CID 18847450) has the molecular formula C33H28FN3O and a molecular weight of 501.61 g/mol. Its IUPAC name is N-ethyl-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-naphthalen-1-ylbutanamide.
| Compound Name | N-ethyl-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-naphthalen-1-ylbutanamide |
|---|---|
| PubChem CID | 18847450 |
| Molecular Formula | C33H28FN3O |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-ethyl-4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-naphthalen-1-ylbutanamide |
| SMILES | CCN(C(=O)CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(F)cc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H28FN3O/c1-2-37(31-15-7-11-22-9-3-5-12-25(22)31)32(38)16-8-13-26-27-21-24(34)18-20-29(27)36-33(26)30-19-17-23-10-4-6-14-28(23)35-30/h3-7,9-12,14-15,17-21,36H,2,8,13,16H2,1H3 |
| InChIKey | QONQNOJSDLEVHS-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|