C23H23N3O — CID 18846865
N,N-dimethyl-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18846865) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N,N-dimethyl-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18846865 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N,N-dimethyl-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | CN(C)C(=O)CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H23N3O/c1-26(2)22(27)13-7-10-18-17-9-4-6-12-20(17)25-23(18)21-15-14-16-8-3-5-11-19(16)24-21/h3-6,8-9,11-12,14-15,25H,7,10,13H2,1-2H3 |
| InChIKey | QCNLVZUGCCIASZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|