About N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide
N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18846946) has the molecular formula C27H21Cl2N3O
and a molecular weight of 474.39 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| PubChem CID | 18846946 |
| Molecular Formula | C27H21Cl2N3O |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccccc12)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H21Cl2N3O/c28-20-10-6-11-21(29)27(20)32-25(33)14-5-9-19-18-8-2-4-13-23(18)31-26(19)24-16-15-17-7-1-3-12-22(17)30-24/h1-4,6-8,10-13,15-16,31H,5,9,14H2,(H,32,33) |
| InChIKey | NKKUZKXXHBUXCI-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide?
The IUPAC name of N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide (CID 18846946) is N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide.
What is the SMILES notation for N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide?
The canonical SMILES for N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide is O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccccc12)Nc1c(Cl)cccc1Cl.
What is the InChIKey of N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide?
The InChIKey is NKKUZKXXHBUXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21Cl2N3O/c28-20-10-6-11-21(29)27(20)32-25(33)14-5-9-19-18-8-2-4-13-23(18)31-26(19)24-16-15-17-7-1-3-12-22(17)30-24/h1-4,6-8,10-13,15-16,31H,5,9,14H2,(H,32,33).
What are the key properties of N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide?
N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide has a molecular weight of 474.39 g/mol, XLogP of 7.65, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide is sourced from PubChem (CID 18846946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).