C27H21Cl2N3O — CID 18846946
N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18846946) has the molecular formula C27H21Cl2N3O and a molecular weight of 474.39 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18846946 |
| Molecular Formula | C27H21Cl2N3O |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccccc12)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H21Cl2N3O/c28-20-10-6-11-21(29)27(20)32-25(33)14-5-9-19-18-8-2-4-13-23(18)31-26(19)24-16-15-17-7-1-3-12-22(17)30-24/h1-4,6-8,10-13,15-16,31H,5,9,14H2,(H,32,33) |
| InChIKey | NKKUZKXXHBUXCI-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|