C31H31N3O — CID 18846827
N-(4-butylphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18846827) has the molecular formula C31H31N3O and a molecular weight of 461.61 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(4-butylphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18846827 |
| Molecular Formula | C31H31N3O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-(4-butylphenyl)-4-(2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | CCCCc1ccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C31H31N3O/c1-2-3-9-22-16-19-24(20-17-22)32-30(35)15-8-12-26-25-11-5-7-14-28(25)34-31(26)29-21-18-23-10-4-6-13-27(23)33-29/h4-7,10-11,13-14,16-21,34H,2-3,8-9,12,15H2,1H3,(H,32,35) |
| InChIKey | ZJUMCMGERRBNFH-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|