C29H26ClN3O2 — CID 18847249
4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-ethoxyphenyl)butanamide (PubChem CID 18847249) has the molecular formula C29H26ClN3O2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-ethoxyphenyl)butanamide.
| Compound Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 18847249 |
| Molecular Formula | C29H26ClN3O2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C29H26ClN3O2/c1-2-35-22-14-12-21(13-15-22)31-28(34)9-5-7-23-24-18-20(30)11-17-26(24)33-29(23)27-16-10-19-6-3-4-8-25(19)32-27/h3-4,6,8,10-18,33H,2,5,7,9H2,1H3,(H,31,34) |
| InChIKey | XEEPSIMGLBKGOT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|