About 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide
4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide (PubChem CID 18847215) has the molecular formula C27H23ClN4O
and a molecular weight of 454.96 g/mol. Its IUPAC name is 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide.
Molecular Properties
| Compound Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide |
| PubChem CID | 18847215 |
| Molecular Formula | C27H23ClN4O |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(Cl)cc12)NNc1ccccc1 |
| InChI | InChI=1S/C27H23ClN4O/c28-19-14-16-24-22(17-19)21(10-6-12-26(33)32-31-20-8-2-1-3-9-20)27(30-24)25-15-13-18-7-4-5-11-23(18)29-25/h1-5,7-9,11,13-17,30-31H,6,10,12H2,(H,32,33) |
| InChIKey | AGSXVWSYZLEINX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide?
The IUPAC name of 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide (CID 18847215) is 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide.
What is the SMILES notation for 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide?
The canonical SMILES for 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide is O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(Cl)cc12)NNc1ccccc1.
What is the InChIKey of 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide?
The InChIKey is AGSXVWSYZLEINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23ClN4O/c28-19-14-16-24-22(17-19)21(10-6-12-26(33)32-31-20-8-2-1-3-9-20)27(30-24)25-15-13-18-7-4-5-11-23(18)29-25/h1-5,7-9,11,13-17,30-31H,6,10,12H2,(H,32,33).
What are the key properties of 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide?
4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide has a molecular weight of 454.96 g/mol, XLogP of 6.50, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide is sourced from PubChem (CID 18847215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).