C27H23ClN4O — CID 18847215
4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide (PubChem CID 18847215) has the molecular formula C27H23ClN4O and a molecular weight of 454.96 g/mol. Its IUPAC name is 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide.
| Compound Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide |
|---|---|
| PubChem CID | 18847215 |
| Molecular Formula | C27H23ClN4O |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-(5-chloro-2-quinolin-2-yl-1H-indol-3-yl)-N'-phenylbutanehydrazide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(Cl)cc12)NNc1ccccc1 |
| InChI | InChI=1S/C27H23ClN4O/c28-19-14-16-24-22(17-19)21(10-6-12-26(33)32-31-20-8-2-1-3-9-20)27(30-24)25-15-13-18-7-4-5-11-23(18)29-25/h1-5,7-9,11,13-17,30-31H,6,10,12H2,(H,32,33) |
| InChIKey | AGSXVWSYZLEINX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|