C29H25FN4O2 — CID 18847440
4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N'-(2-phenylacetyl)butanehydrazide (PubChem CID 18847440) has the molecular formula C29H25FN4O2 and a molecular weight of 480.54 g/mol. Its IUPAC name is 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N'-(2-phenylacetyl)butanehydrazide.
| Compound Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N'-(2-phenylacetyl)butanehydrazide |
|---|---|
| PubChem CID | 18847440 |
| Molecular Formula | C29H25FN4O2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N'-(2-phenylacetyl)butanehydrazide |
| SMILES | O=C(CCCc1c(-c2ccc3ccccc3n2)[nH]c2ccc(F)cc12)NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H25FN4O2/c30-21-14-16-25-23(18-21)22(29(32-25)26-15-13-20-9-4-5-11-24(20)31-26)10-6-12-27(35)33-34-28(36)17-19-7-2-1-3-8-19/h1-5,7-9,11,13-16,18,32H,6,10,12,17H2,(H,33,35)(H,34,36) |
| InChIKey | IYKLFVJPABIBLE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|