C28H24FN3O2 — CID 18847417
4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-methoxyphenyl)butanamide (PubChem CID 18847417) has the molecular formula C28H24FN3O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-methoxyphenyl)butanamide.
| Compound Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 18847417 |
| Molecular Formula | C28H24FN3O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-(5-fluoro-2-quinolin-2-yl-1H-indol-3-yl)-N-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C28H24FN3O2/c1-34-21-13-11-20(12-14-21)30-27(33)8-4-6-22-23-17-19(29)10-16-25(23)32-28(22)26-15-9-18-5-2-3-7-24(18)31-26/h2-3,5,7,9-17,32H,4,6,8H2,1H3,(H,30,33) |
| InChIKey | GZXIBQDBRFCVRI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|