C29H26N4O4 — CID 18847083
N-(4-methoxy-2-nitrophenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18847083) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18847083 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccc(C)cc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H26N4O4/c1-18-10-13-24-22(16-18)21(29(32-24)26-14-11-19-6-3-4-8-23(19)30-26)7-5-9-28(34)31-25-15-12-20(37-2)17-27(25)33(35)36/h3-4,6,8,10-17,32H,5,7,9H2,1-2H3,(H,31,34) |
| InChIKey | DHPBQFZHSJSZCG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|