C30H28N4O3 — CID 18847099
4-methoxy-N'-[4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide (PubChem CID 18847099) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-methoxy-N'-[4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 18847099 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-methoxy-N'-[4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)butanoyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CCCc2c(-c3ccc4ccccc4n3)[nH]c3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C30H28N4O3/c1-19-10-16-26-24(18-19)23(29(32-26)27-17-13-20-6-3-4-8-25(20)31-27)7-5-9-28(35)33-34-30(36)21-11-14-22(37-2)15-12-21/h3-4,6,8,10-18,32H,5,7,9H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | KXLVPGGFOYLMHR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|