C28H26N4O — CID 18846980
4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 18846980) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | 4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 18846980 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-(5-methyl-2-quinolin-2-yl-1H-indol-3-yl)-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | Cc1ccc2[nH]c(-c3ccc4ccccc4n3)c(CCCC(=O)NCc3ccccn3)c2c1 |
| InChI | InChI=1S/C28H26N4O/c1-19-12-14-25-23(17-19)22(9-6-11-27(33)30-18-21-8-4-5-16-29-21)28(32-25)26-15-13-20-7-2-3-10-24(20)31-26/h2-5,7-8,10,12-17,32H,6,9,11,18H2,1H3,(H,30,33) |
| InChIKey | FMNPGEFHNMFZPY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|