C23H23N3O2 — CID 18832771
N-(furan-2-ylmethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18832771) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18832771 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | Cc1ccc2[nH]c(-c3ccccn3)c(CCCC(=O)NCc3ccco3)c2c1 |
| InChI | InChI=1S/C23H23N3O2/c1-16-10-11-20-19(14-16)18(23(26-20)21-8-2-3-12-24-21)7-4-9-22(27)25-15-17-6-5-13-28-17/h2-3,5-6,8,10-14,26H,4,7,9,15H2,1H3,(H,25,27) |
| InChIKey | HTFKSSDJTCJLGI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|