C27H27N3O3 — CID 18832865
ethyl 2-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoylamino]benzoate (PubChem CID 18832865) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is ethyl 2-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoylamino]benzoate.
| Compound Name | ethyl 2-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 18832865 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | ethyl 2-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CCCc1c(-c2ccccn2)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C27H27N3O3/c1-3-33-27(32)20-9-4-5-11-22(20)29-25(31)13-8-10-19-21-17-18(2)14-15-23(21)30-26(19)24-12-6-7-16-28-24/h4-7,9,11-12,14-17,30H,3,8,10,13H2,1-2H3,(H,29,31) |
| InChIKey | VKFDCSGTYRRIBQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|