C25H23N5O4 — CID 18832813
N'-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoyl]-2-nitrobenzohydrazide (PubChem CID 18832813) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is N'-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoyl]-2-nitrobenzohydrazide.
| Compound Name | N'-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoyl]-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 18832813 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N'-[4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanoyl]-2-nitrobenzohydrazide |
| SMILES | Cc1ccc2[nH]c(-c3ccccn3)c(CCCC(=O)NNC(=O)c3ccccc3[N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C25H23N5O4/c1-16-12-13-20-19(15-16)17(24(27-20)21-9-4-5-14-26-21)8-6-11-23(31)28-29-25(32)18-7-2-3-10-22(18)30(33)34/h2-5,7,9-10,12-15,27H,6,8,11H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | HBPKJFGYOWWOEL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|