C25H23FN4O3 — CID 18833244
N-(2,4-dimethyl-6-nitrophenyl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18833244) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is N-(2,4-dimethyl-6-nitrophenyl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(2,4-dimethyl-6-nitrophenyl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18833244 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-(2,4-dimethyl-6-nitrophenyl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCc2c(-c3ccccn3)[nH]c3ccc(F)cc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H23FN4O3/c1-15-12-16(2)24(22(13-15)30(32)33)29-23(31)8-5-6-18-19-14-17(26)9-10-20(19)28-25(18)21-7-3-4-11-27-21/h3-4,7,9-14,28H,5-6,8H2,1-2H3,(H,29,31) |
| InChIKey | GWFUWLDVYZPOPV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|