C24H19F4N3O — CID 18833128
4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide (PubChem CID 18833128) has the molecular formula C24H19F4N3O and a molecular weight of 441.43 g/mol. Its IUPAC name is 4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 18833128 |
| Molecular Formula | C24H19F4N3O |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(F)cc12)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H19F4N3O/c25-15-11-12-19-17(14-15)16(23(31-19)21-9-3-4-13-29-21)6-5-10-22(32)30-20-8-2-1-7-18(20)24(26,27)28/h1-4,7-9,11-14,31H,5-6,10H2,(H,30,32) |
| InChIKey | VSNWBKVJWFENAK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|