C29H24FN5O — CID 18833173
4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-phenyldiazenylphenyl)butanamide (PubChem CID 18833173) has the molecular formula C29H24FN5O and a molecular weight of 477.54 g/mol. Its IUPAC name is 4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-phenyldiazenylphenyl)butanamide.
| Compound Name | 4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-phenyldiazenylphenyl)butanamide |
|---|---|
| PubChem CID | 18833173 |
| Molecular Formula | C29H24FN5O |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-phenyldiazenylphenyl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(F)cc12)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24FN5O/c30-20-12-17-26-25(19-20)24(29(33-26)27-10-4-5-18-31-27)9-6-11-28(36)32-21-13-15-23(16-14-21)35-34-22-7-2-1-3-8-22/h1-5,7-8,10,12-19,33H,6,9,11H2,(H,32,36)/b35-34+ |
| InChIKey | SXGCNFCSLGZYMB-XAHDOWKMSA-N |
| XLogP | 7.75 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|