C23H19ClIN3O — CID 18832998
4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-iodophenyl)butanamide (PubChem CID 18832998) has the molecular formula C23H19ClIN3O and a molecular weight of 515.78 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-iodophenyl)butanamide.
| Compound Name | 4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 18832998 |
| Molecular Formula | C23H19ClIN3O |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(4-iodophenyl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(Cl)cc12)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C23H19ClIN3O/c24-15-7-12-20-19(14-15)18(23(28-20)21-5-1-2-13-26-21)4-3-6-22(29)27-17-10-8-16(25)9-11-17/h1-2,5,7-14,28H,3-4,6H2,(H,27,29) |
| InChIKey | IAWYWILPMRZHLT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|