C23H19Cl2N3O — CID 18827506
N-(2,5-dichlorophenyl)-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18827506) has the molecular formula C23H19Cl2N3O and a molecular weight of 424.33 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18827506 |
| Molecular Formula | C23H19Cl2N3O |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccccc12)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H19Cl2N3O/c24-15-11-12-18(25)21(14-15)27-22(29)10-5-7-17-16-6-1-2-8-19(16)28-23(17)20-9-3-4-13-26-20/h1-4,6,8-9,11-14,28H,5,7,10H2,(H,27,29) |
| InChIKey | REOLANHISUDXNV-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|