C26H27N3O — CID 18832695
N-(2,3-dimethylphenyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide (PubChem CID 18832695) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 18832695 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)butanamide |
| SMILES | Cc1ccc2[nH]c(-c3ccccn3)c(CCCC(=O)Nc3cccc(C)c3C)c2c1 |
| InChI | InChI=1S/C26H27N3O/c1-17-13-14-23-21(16-17)20(26(29-23)24-10-4-5-15-27-24)9-7-12-25(30)28-22-11-6-8-18(2)19(22)3/h4-6,8,10-11,13-16,29H,7,9,12H2,1-3H3,(H,28,30) |
| InChIKey | ASCLFSJOTHNVPS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|