C24H22N4O3 — CID 18832791
4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)-N-(3-nitrophenyl)butanamide (PubChem CID 18832791) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)-N-(3-nitrophenyl)butanamide.
| Compound Name | 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)-N-(3-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 18832791 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-(5-methyl-2-pyridin-2-yl-1H-indol-3-yl)-N-(3-nitrophenyl)butanamide |
| SMILES | Cc1ccc2[nH]c(-c3ccccn3)c(CCCC(=O)Nc3cccc([N+](=O)[O-])c3)c2c1 |
| InChI | InChI=1S/C24H22N4O3/c1-16-11-12-21-20(14-16)19(24(27-21)22-9-2-3-13-25-22)8-5-10-23(29)26-17-6-4-7-18(15-17)28(30)31/h2-4,6-7,9,11-15,27H,5,8,10H2,1H3,(H,26,29) |
| InChIKey | GAAVTUWCZGOKNL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|